C36H60N2O5 — CID 14093876
bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate (PubChem CID 14093876) has the molecular formula C36H60N2O5 and a molecular weight of 600.89 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate.
| Compound Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 14093876 |
| Molecular Formula | C36H60N2O5 |
| Molecular Weight | 600.89 g/mol |
| Exact Mass | 600.45 |
| IUPAC Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate |
| SMILES | CC1(C)CC(OC(=O)C(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C(=O)OC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C36H60N2O5/c1-31(2,3)26-16-22(17-27(28(26)39)32(4,5)6)15-25(29(40)42-23-18-33(7,8)37-34(9,10)19-23)30(41)43-24-20-35(11,12)38-36(13,14)21-24/h16-17,23-25,37-39H,15,18-21H2,1-14H3 |
| InChIKey | REFOYRYSMHHBCM-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.89 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|