C31H37N9O5 — CID 140938864
tert-butyl N-[1-[6-[3-[(4-nitrobenzoyl)amino]anilino]-9-propan-2-ylpurin-2-yl]piperidin-3-yl]carbamate (PubChem CID 140938864) has the molecular formula C31H37N9O5 and a molecular weight of 615.70 g/mol. Its IUPAC name is tert-butyl N-[1-[6-[3-[(4-nitrobenzoyl)amino]anilino]-9-propan-2-ylpurin-2-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[6-[3-[(4-nitrobenzoyl)amino]anilino]-9-propan-2-ylpurin-2-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 140938864 |
| Molecular Formula | C31H37N9O5 |
| Molecular Weight | 615.70 g/mol |
| Exact Mass | 615.29 |
| IUPAC Name | tert-butyl N-[1-[6-[3-[(4-nitrobenzoyl)amino]anilino]-9-propan-2-ylpurin-2-yl]piperidin-3-yl]carbamate |
| SMILES | CC(C)n1cnc2c(Nc3cccc(NC(=O)c4ccc([N+](=O)[O-])cc4)c3)nc(N3CCCC(NC(=O)OC(C)(C)C)C3)nc21 |
| InChI | InChI=1S/C31H37N9O5/c1-19(2)39-18-32-25-26(33-21-8-6-9-22(16-21)34-28(41)20-11-13-24(14-12-20)40(43)44)36-29(37-27(25)39)38-15-7-10-23(17-38)35-30(42)45-31(3,4)5/h6,8-9,11-14,16,18-19,23H,7,10,15,17H2,1-5H3,(H,34,41)(H,35,42)(H,33,36,37) |
| InChIKey | FRGAECJTQXSWPH-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 169.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.70 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|