C15H26O — CID 14093951
(3E,7E)-1,5,5,8-tetramethylcycloundeca-3,7-dien-1-ol (PubChem CID 14093951) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is (3E,7E)-1,5,5,8-tetramethylcycloundeca-3,7-dien-1-ol.
| Compound Name | (3E,7E)-1,5,5,8-tetramethylcycloundeca-3,7-dien-1-ol |
|---|---|
| PubChem CID | 14093951 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | (3E,7E)-1,5,5,8-tetramethylcycloundeca-3,7-dien-1-ol |
| SMILES | C/C1=C\CC(C)(C)/C=C/CC(C)(O)CCC1 |
| InChI | InChI=1S/C15H26O/c1-13-7-5-10-15(4,16)11-6-9-14(2,3)12-8-13/h6,8-9,16H,5,7,10-12H2,1-4H3/b9-6+,13-8+ |
| InChIKey | ZLMAVMBYWKVCLV-IMWXLZLDSA-N |
| XLogP | 4.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|