C31H33N3 — CID 140940572
7-[(2S)-2,3-dimethyl-2H-benzimidazol-1-yl]-5,5,6,6,8-pentamethylnaphtho[1,2-h]quinoline (PubChem CID 140940572) has the molecular formula C31H33N3 and a molecular weight of 447.63 g/mol. Its IUPAC name is 7-[(2S)-2,3-dimethyl-2H-benzimidazol-1-yl]-5,5,6,6,8-pentamethylnaphtho[1,2-h]quinoline.
| Compound Name | 7-[(2S)-2,3-dimethyl-2H-benzimidazol-1-yl]-5,5,6,6,8-pentamethylnaphtho[1,2-h]quinoline |
|---|---|
| PubChem CID | 140940572 |
| Molecular Formula | C31H33N3 |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | 7-[(2S)-2,3-dimethyl-2H-benzimidazol-1-yl]-5,5,6,6,8-pentamethylnaphtho[1,2-h]quinoline |
| SMILES | Cc1ccc2c(c1N1c3ccccc3N(C)[C@@H]1C)C(C)(C)C(C)(C)c1c-2ccc2cccnc12 |
| InChI | InChI=1S/C31H33N3/c1-19-14-16-23-22-17-15-21-11-10-18-32-28(21)26(22)30(3,4)31(5,6)27(23)29(19)34-20(2)33(7)24-12-8-9-13-25(24)34/h8-18,20H,1-7H3/t20-/m0/s1 |
| InChIKey | ZIRRDIOFQYQSDR-FQEVSTJZSA-N |
| XLogP | 7.71 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |