C31H17F9N2O3S — CID 140941037
[2-(3-phenylphenanthro[9,10-d]imidazol-2-yl)phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 140941037) has the molecular formula C31H17F9N2O3S and a molecular weight of 668.54 g/mol. Its IUPAC name is [2-(3-phenylphenanthro[9,10-d]imidazol-2-yl)phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [2-(3-phenylphenanthro[9,10-d]imidazol-2-yl)phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 140941037 |
| Molecular Formula | C31H17F9N2O3S |
| Molecular Weight | 668.54 g/mol |
| Exact Mass | 668.08 |
| IUPAC Name | [2-(3-phenylphenanthro[9,10-d]imidazol-2-yl)phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=S(=O)(Oc1ccccc1-c1nc2c3ccccc3c3ccccc3c2n1-c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C31H17F9N2O3S/c32-28(33,30(36,37)38)29(34,35)31(39,40)46(43,44)45-24-17-9-8-16-23(24)27-41-25-21-14-6-4-12-19(21)20-13-5-7-15-22(20)26(25)42(27)18-10-2-1-3-11-18/h1-17H |
| InChIKey | XJSIBQUCUODNPM-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.54 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|