C43H54O6P2 — CID 14094162
3,9-bis[2-tert-butyl-4-(2-phenylpropan-2-yl)phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane (PubChem CID 14094162) has the molecular formula C43H54O6P2 and a molecular weight of 728.85 g/mol. Its IUPAC name is 3,9-bis[2-tert-butyl-4-(2-phenylpropan-2-yl)phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane.
| Compound Name | 3,9-bis[2-tert-butyl-4-(2-phenylpropan-2-yl)phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
|---|---|
| PubChem CID | 14094162 |
| Molecular Formula | C43H54O6P2 |
| Molecular Weight | 728.85 g/mol |
| Exact Mass | 728.34 |
| IUPAC Name | 3,9-bis[2-tert-butyl-4-(2-phenylpropan-2-yl)phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
| SMILES | CC(C)(C)c1cc(C(C)(C)c2ccccc2)ccc1OP1OCC2(CO1)COP(Oc1ccc(C(C)(C)c3ccccc3)cc1C(C)(C)C)OC2 |
| InChI | InChI=1S/C43H54O6P2/c1-39(2,3)35-25-33(41(7,8)31-17-13-11-14-18-31)21-23-37(35)48-50-44-27-43(28-45-50)29-46-51(47-30-43)49-38-24-22-34(26-36(38)40(4,5)6)42(9,10)32-19-15-12-16-20-32/h11-26H,27-30H2,1-10H3 |
| InChIKey | RCUJDGHXWVMABP-UHFFFAOYSA-N |
| XLogP | 11.93 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.85 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|