C16H22NO5+ — CID 140942794
benzyl-dimethyl-[(5-methyl-2-oxo-1,3-dioxane-5-carbonyl)oxymethyl]azanium (PubChem CID 140942794) has the molecular formula C16H22NO5+ and a molecular weight of 308.35 g/mol. Its IUPAC name is benzyl-dimethyl-[(5-methyl-2-oxo-1,3-dioxane-5-carbonyl)oxymethyl]azanium.
| Compound Name | benzyl-dimethyl-[(5-methyl-2-oxo-1,3-dioxane-5-carbonyl)oxymethyl]azanium |
|---|---|
| PubChem CID | 140942794 |
| Molecular Formula | C16H22NO5+ |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | benzyl-dimethyl-[(5-methyl-2-oxo-1,3-dioxane-5-carbonyl)oxymethyl]azanium |
| SMILES | CC1(C(=O)OC[N+](C)(C)Cc2ccccc2)COC(=O)OC1 |
| InChI | InChI=1S/C16H22NO5/c1-16(10-20-15(19)21-11-16)14(18)22-12-17(2,3)9-13-7-5-4-6-8-13/h4-8H,9-12H2,1-3H3/q+1 |
| InChIKey | PCYBZJXPXGZYBO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|