C7H13F2NO — CID 140943328
(2R)-2-(difluoromethyl)-2,3-dimethylbutanamide (PubChem CID 140943328) has the molecular formula C7H13F2NO and a molecular weight of 165.18 g/mol. Its IUPAC name is (2R)-2-(difluoromethyl)-2,3-dimethylbutanamide.
| Compound Name | (2R)-2-(difluoromethyl)-2,3-dimethylbutanamide |
|---|---|
| PubChem CID | 140943328 |
| Molecular Formula | C7H13F2NO |
| Molecular Weight | 165.18 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | (2R)-2-(difluoromethyl)-2,3-dimethylbutanamide |
| SMILES | CC(C)[C@](C)(C(N)=O)C(F)F |
| InChI | InChI=1S/C7H13F2NO/c1-4(2)7(3,5(8)9)6(10)11/h4-5H,1-3H3,(H2,10,11)/t7-/m0/s1 |
| InChIKey | WCXFIMPIWPIUNY-ZETCQYMHSA-N |
| XLogP | 1.40 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.18 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |