C20H27N — CID 140943602
3-tert-butyl-2-methyl-6-[4-(2-methylpropyl)phenyl]pyridine (PubChem CID 140943602) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is 3-tert-butyl-2-methyl-6-[4-(2-methylpropyl)phenyl]pyridine.
| Compound Name | 3-tert-butyl-2-methyl-6-[4-(2-methylpropyl)phenyl]pyridine |
|---|---|
| PubChem CID | 140943602 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 3-tert-butyl-2-methyl-6-[4-(2-methylpropyl)phenyl]pyridine |
| SMILES | Cc1nc(-c2ccc(CC(C)C)cc2)ccc1C(C)(C)C |
| InChI | InChI=1S/C20H27N/c1-14(2)13-16-7-9-17(10-8-16)19-12-11-18(15(3)21-19)20(4,5)6/h7-12,14H,13H2,1-6H3 |
| InChIKey | LOLLULOHJRAKLS-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |