C21H23N4+ — CID 140944429
7-methyl-6-[1,3,5-trimethyl-6-(2-methylphenyl)pyridin-1-ium-2-yl]imidazo[1,2-a]imidazole (PubChem CID 140944429) has the molecular formula C21H23N4+ and a molecular weight of 331.44 g/mol. Its IUPAC name is 7-methyl-6-[1,3,5-trimethyl-6-(2-methylphenyl)pyridin-1-ium-2-yl]imidazo[1,2-a]imidazole.
| Compound Name | 7-methyl-6-[1,3,5-trimethyl-6-(2-methylphenyl)pyridin-1-ium-2-yl]imidazo[1,2-a]imidazole |
|---|---|
| PubChem CID | 140944429 |
| Molecular Formula | C21H23N4+ |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 7-methyl-6-[1,3,5-trimethyl-6-(2-methylphenyl)pyridin-1-ium-2-yl]imidazo[1,2-a]imidazole |
| SMILES | Cc1ccccc1-c1c(C)cc(C)c(-c2cn3ccnc3n2C)[n+]1C |
| InChI | InChI=1S/C21H23N4/c1-14-8-6-7-9-17(14)19-15(2)12-16(3)20(24(19)5)18-13-25-11-10-22-21(25)23(18)4/h6-13H,1-5H3/q+1 |
| InChIKey | DYSONXNUEZRSAM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 26.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|