C23H20FN7O — CID 140944789
[2-(5-fluoro-3-pyridinyl)-4-(2,3,4,9-tetrahydro-1H-carbazol-3-ylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methanol (PubChem CID 140944789) has the molecular formula C23H20FN7O and a molecular weight of 429.46 g/mol. Its IUPAC name is [2-(5-fluoro-3-pyridinyl)-4-(2,3,4,9-tetrahydro-1H-carbazol-3-ylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methanol.
| Compound Name | [2-(5-fluoro-3-pyridinyl)-4-(2,3,4,9-tetrahydro-1H-carbazol-3-ylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methanol |
|---|---|
| PubChem CID | 140944789 |
| Molecular Formula | C23H20FN7O |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | [2-(5-fluoro-3-pyridinyl)-4-(2,3,4,9-tetrahydro-1H-carbazol-3-ylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methanol |
| SMILES | OCc1cnn2c(NC3CCc4[nH]c5ccccc5c4C3)nc(-c3cncc(F)c3)nc12 |
| InChI | InChI=1S/C23H20FN7O/c24-15-7-13(9-25-11-15)21-29-22-14(12-32)10-26-31(22)23(30-21)27-16-5-6-20-18(8-16)17-3-1-2-4-19(17)28-20/h1-4,7,9-11,16,28,32H,5-6,8,12H2,(H,27,29,30) |
| InChIKey | HFBYSOBHZVPLSR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|