C5H6N2O2 — CID 14094556
1-ethenylimidazolidine-2,4-dione (PubChem CID 14094556) has the molecular formula C5H6N2O2 and a molecular weight of 126.11 g/mol. Its IUPAC name is 1-ethenylimidazolidine-2,4-dione.
| Compound Name | 1-ethenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 14094556 |
| Molecular Formula | C5H6N2O2 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.04 |
| IUPAC Name | 1-ethenylimidazolidine-2,4-dione |
| SMILES | C=CN1CC(=O)NC1=O |
| InChI | InChI=1S/C5H6N2O2/c1-2-7-3-4(8)6-5(7)9/h2H,1,3H2,(H,6,8,9) |
| InChIKey | JEDXQONAOMHEQO-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|