C51H33N3O — CID 140946169
2,4-diphenyl-6-[8-[3-phenyl-5-(3-phenylphenyl)phenyl]dibenzofuran-1-yl]-1,3,5-triazine (PubChem CID 140946169) has the molecular formula C51H33N3O and a molecular weight of 703.85 g/mol. Its IUPAC name is 2,4-diphenyl-6-[8-[3-phenyl-5-(3-phenylphenyl)phenyl]dibenzofuran-1-yl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[8-[3-phenyl-5-(3-phenylphenyl)phenyl]dibenzofuran-1-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 140946169 |
| Molecular Formula | C51H33N3O |
| Molecular Weight | 703.85 g/mol |
| Exact Mass | 703.26 |
| IUPAC Name | 2,4-diphenyl-6-[8-[3-phenyl-5-(3-phenylphenyl)phenyl]dibenzofuran-1-yl]-1,3,5-triazine |
| SMILES | c1ccc(-c2cccc(-c3cc(-c4ccccc4)cc(-c4ccc5oc6cccc(-c7nc(-c8ccccc8)nc(-c8ccccc8)n7)c6c5c4)c3)c2)cc1 |
| InChI | InChI=1S/C51H33N3O/c1-5-15-34(16-6-1)38-23-13-24-39(29-38)42-30-41(35-17-7-2-8-18-35)31-43(32-42)40-27-28-46-45(33-40)48-44(25-14-26-47(48)55-46)51-53-49(36-19-9-3-10-20-36)52-50(54-51)37-21-11-4-12-22-37/h1-33H |
| InChIKey | ZWPRYDXNDWOEBX-UHFFFAOYSA-N |
| XLogP | 13.44 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.85 |
| LogP ≤ 5 | 13.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |