About N-(1-but-2-ynyl-4,4-difluorocyclohexyl)pent-3-ynamide
N-(1-but-2-ynyl-4,4-difluorocyclohexyl)pent-3-ynamide (PubChem CID 140946951) has the molecular formula C15H19F2NO
and a molecular weight of 267.32 g/mol. Its IUPAC name is N-(1-but-2-ynyl-4,4-difluorocyclohexyl)pent-3-ynamide.
Molecular Properties
| Compound Name | N-(1-but-2-ynyl-4,4-difluorocyclohexyl)pent-3-ynamide |
| PubChem CID | 140946951 |
| Molecular Formula | C15H19F2NO |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N-(1-but-2-ynyl-4,4-difluorocyclohexyl)pent-3-ynamide |
| SMILES | CC#CCC(=O)NC1(CC#CC)CCC(F)(F)CC1 |
| InChI | InChI=1S/C15H19F2NO/c1-3-5-7-13(19)18-14(8-6-4-2)9-11-15(16,17)12-10-14/h7-12H2,1-2H3,(H,18,19) |
| InChIKey | JJKSVSAEODCBGK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(1-but-2-ynyl-4,4-difluorocyclohexyl)pent-3-ynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-but-2-ynyl-4,4-difluorocyclohexyl)pent-3-ynamide?
The IUPAC name of N-(1-but-2-ynyl-4,4-difluorocyclohexyl)pent-3-ynamide (CID 140946951) is N-(1-but-2-ynyl-4,4-difluorocyclohexyl)pent-3-ynamide.
What is the SMILES notation for N-(1-but-2-ynyl-4,4-difluorocyclohexyl)pent-3-ynamide?
The canonical SMILES for N-(1-but-2-ynyl-4,4-difluorocyclohexyl)pent-3-ynamide is CC#CCC(=O)NC1(CC#CC)CCC(F)(F)CC1.
What is the InChIKey of N-(1-but-2-ynyl-4,4-difluorocyclohexyl)pent-3-ynamide?
The InChIKey is JJKSVSAEODCBGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F2NO/c1-3-5-7-13(19)18-14(8-6-4-2)9-11-15(16,17)12-10-14/h7-12H2,1-2H3,(H,18,19).
What are the key properties of N-(1-but-2-ynyl-4,4-difluorocyclohexyl)pent-3-ynamide?
N-(1-but-2-ynyl-4,4-difluorocyclohexyl)pent-3-ynamide has a molecular weight of 267.32 g/mol, XLogP of 2.88, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-but-2-ynyl-4,4-difluorocyclohexyl)pent-3-ynamide is sourced from PubChem (CID 140946951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).