C23H22N5+ — CID 140948178
7,8,11-trimethyl-1,8,15,22-tetraza-9-azoniaheptacyclo[12.9.1.12,6.010,24.015,23.016,21.09,25]pentacosa-6,9(25),10,12,14(24),16,18,20,22-nonaene (PubChem CID 140948178) has the molecular formula C23H22N5+ and a molecular weight of 368.46 g/mol. Its IUPAC name is 7,8,11-trimethyl-1,8,15,22-tetraza-9-azoniaheptacyclo[12.9.1.12,6.010,24.015,23.016,21.09,25]pentacosa-6,9(25),10,12,14(24),16,18,20,22-nonaene.
| Compound Name | 7,8,11-trimethyl-1,8,15,22-tetraza-9-azoniaheptacyclo[12.9.1.12,6.010,24.015,23.016,21.09,25]pentacosa-6,9(25),10,12,14(24),16,18,20,22-nonaene |
|---|---|
| PubChem CID | 140948178 |
| Molecular Formula | C23H22N5+ |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 7,8,11-trimethyl-1,8,15,22-tetraza-9-azoniaheptacyclo[12.9.1.12,6.010,24.015,23.016,21.09,25]pentacosa-6,9(25),10,12,14(24),16,18,20,22-nonaene |
| SMILES | Cc1ccc2c3c1-[n+]1c4c(c(C)n1C)CCCC4n3c1nc3ccccc3n21 |
| InChI | InChI=1S/C23H22N5/c1-13-11-12-19-22-20(13)28-21-15(14(2)25(28)3)7-6-10-18(21)27(22)23-24-16-8-4-5-9-17(16)26(19)23/h4-5,8-9,11-12,18H,6-7,10H2,1-3H3/q+1 |
| InChIKey | ZOYVVWLJCRXPDB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 31.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|