C29H25N4+ — CID 140948189
2,2,7,10-tetramethyl-5-phenyl-1,14,21-triaza-7-azoniahexacyclo[11.9.1.03,8.09,23.014,22.015,20]tricosa-3(8),4,6,9,11,13(23),15,17,19,21-decaene (PubChem CID 140948189) has the molecular formula C29H25N4+ and a molecular weight of 429.55 g/mol. Its IUPAC name is 2,2,7,10-tetramethyl-5-phenyl-1,14,21-triaza-7-azoniahexacyclo[11.9.1.03,8.09,23.014,22.015,20]tricosa-3(8),4,6,9,11,13(23),15,17,19,21-decaene.
| Compound Name | 2,2,7,10-tetramethyl-5-phenyl-1,14,21-triaza-7-azoniahexacyclo[11.9.1.03,8.09,23.014,22.015,20]tricosa-3(8),4,6,9,11,13(23),15,17,19,21-decaene |
|---|---|
| PubChem CID | 140948189 |
| Molecular Formula | C29H25N4+ |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 2,2,7,10-tetramethyl-5-phenyl-1,14,21-triaza-7-azoniahexacyclo[11.9.1.03,8.09,23.014,22.015,20]tricosa-3(8),4,6,9,11,13(23),15,17,19,21-decaene |
| SMILES | Cc1ccc2c3c1-c1c(cc(-c4ccccc4)c[n+]1C)C(C)(C)n3c1nc3ccccc3n21 |
| InChI | InChI=1S/C29H25N4/c1-18-14-15-24-27-25(18)26-21(16-20(17-31(26)4)19-10-6-5-7-11-19)29(2,3)33(27)28-30-22-12-8-9-13-23(22)32(24)28/h5-17H,1-4H3/q+1 |
| InChIKey | YHRZAMARGNKYIK-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 26.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|