About 1-methylpyrrolo[2,3-f][3,7]phenanthroline
1-methylpyrrolo[2,3-f][3,7]phenanthroline (PubChem CID 140949061) has the molecular formula C15H11N3
and a molecular weight of 233.27 g/mol. Its IUPAC name is 1-methylpyrrolo[2,3-f][3,7]phenanthroline.
Molecular Properties
| Compound Name | 1-methylpyrrolo[2,3-f][3,7]phenanthroline |
| PubChem CID | 140949061 |
| Molecular Formula | C15H11N3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 1-methylpyrrolo[2,3-f][3,7]phenanthroline |
| SMILES | Cn1ccc2c3ncccc3c3ccncc3c21 |
| InChI | InChI=1S/C15H11N3/c1-18-8-5-12-14-11(3-2-6-17-14)10-4-7-16-9-13(10)15(12)18/h2-9H,1H3 |
| InChIKey | IMGYWZDKSHSPFS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpyrrolo[2,3-f][3,7]phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrrolo[2,3-f][3,7]phenanthroline?
The IUPAC name of 1-methylpyrrolo[2,3-f][3,7]phenanthroline (CID 140949061) is 1-methylpyrrolo[2,3-f][3,7]phenanthroline.
What is the SMILES notation for 1-methylpyrrolo[2,3-f][3,7]phenanthroline?
The canonical SMILES for 1-methylpyrrolo[2,3-f][3,7]phenanthroline is Cn1ccc2c3ncccc3c3ccncc3c21.
What is the InChIKey of 1-methylpyrrolo[2,3-f][3,7]phenanthroline?
The InChIKey is IMGYWZDKSHSPFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3/c1-18-8-5-12-14-11(3-2-6-17-14)10-4-7-16-9-13(10)15(12)18/h2-9H,1H3.
What are the key properties of 1-methylpyrrolo[2,3-f][3,7]phenanthroline?
1-methylpyrrolo[2,3-f][3,7]phenanthroline has a molecular weight of 233.27 g/mol, XLogP of 3.27, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrrolo[2,3-f][3,7]phenanthroline is sourced from PubChem (CID 140949061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).