C52H40N4OSi — CID 140952698
[3-(14,14-dimethyl-21-oxa-9,11-diazapentacyclo[11.8.0.02,10.03,8.015,20]henicosa-1,3,5,7,10,12,15,17,19-nonaen-9-yl)phenyl]-[3-(1-methylbenzimidazol-2-yl)phenyl]-diphenylsilane (PubChem CID 140952698) has the molecular formula C52H40N4OSi and a molecular weight of 765.01 g/mol. Its IUPAC name is [3-(14,14-dimethyl-21-oxa-9,11-diazapentacyclo[11.8.0.02,10.03,8.015,20]henicosa-1,3,5,7,10,12,15,17,19-nonaen-9-yl)phenyl]-[3-(1-methylbenzimidazol-2-yl)phenyl]-diphenylsilane.
| Compound Name | [3-(14,14-dimethyl-21-oxa-9,11-diazapentacyclo[11.8.0.02,10.03,8.015,20]henicosa-1,3,5,7,10,12,15,17,19-nonaen-9-yl)phenyl]-[3-(1-methylbenzimidazol-2-yl)phenyl]-diphenylsilane |
|---|---|
| PubChem CID | 140952698 |
| Molecular Formula | C52H40N4OSi |
| Molecular Weight | 765.01 g/mol |
| Exact Mass | 764.30 |
| IUPAC Name | [3-(14,14-dimethyl-21-oxa-9,11-diazapentacyclo[11.8.0.02,10.03,8.015,20]henicosa-1,3,5,7,10,12,15,17,19-nonaen-9-yl)phenyl]-[3-(1-methylbenzimidazol-2-yl)phenyl]-diphenylsilane |
| SMILES | Cn1c(-c2cccc([Si](c3ccccc3)(c3ccccc3)c3cccc(-n4c5ccccc5c5c6c(cnc54)C(C)(C)c4ccccc4O6)c3)c2)nc2ccccc21 |
| InChI | InChI=1S/C52H40N4OSi/c1-52(2)42-27-11-15-31-47(42)57-49-43(52)34-53-51-48(49)41-26-10-13-29-45(41)56(51)36-19-17-25-40(33-36)58(37-20-6-4-7-21-37,38-22-8-5-9-23-38)39-24-16-18-35(32-39)50-54-44-28-12-14-30-46(44)55(50)3/h4-34H,1-3H3 |
| InChIKey | HRLZXSZEEOLGNW-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.01 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|