C58H41N3SSi2 — CID 140954516
(13,13-diphenyl-8-pyridin-2-yl-[1,4]benzothiasilino[3,2-g]carbazol-10-yl)-diphenyl-(3-pyridin-2-ylphenyl)silane (PubChem CID 140954516) has the molecular formula C58H41N3SSi2 and a molecular weight of 868.23 g/mol. Its IUPAC name is (13,13-diphenyl-8-pyridin-2-yl-[1,4]benzothiasilino[3,2-g]carbazol-10-yl)-diphenyl-(3-pyridin-2-ylphenyl)silane.
| Compound Name | (13,13-diphenyl-8-pyridin-2-yl-[1,4]benzothiasilino[3,2-g]carbazol-10-yl)-diphenyl-(3-pyridin-2-ylphenyl)silane |
|---|---|
| PubChem CID | 140954516 |
| Molecular Formula | C58H41N3SSi2 |
| Molecular Weight | 868.23 g/mol |
| Exact Mass | 867.26 |
| IUPAC Name | (13,13-diphenyl-8-pyridin-2-yl-[1,4]benzothiasilino[3,2-g]carbazol-10-yl)-diphenyl-(3-pyridin-2-ylphenyl)silane |
| SMILES | c1ccc([Si](c2ccccc2)(c2cccc(-c3ccccn3)c2)c2ccc3c4c5c(ccc4n(-c4ccccn4)c3c2)Sc2ccccc2[Si]5(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C58H41N3SSi2/c1-5-21-43(22-6-1)63(44-23-7-2-8-24-44,47-29-19-20-42(40-47)50-30-15-17-38-59-50)48-34-35-49-52(41-48)61(56-33-16-18-39-60-56)51-36-37-54-58(57(49)51)64(45-25-9-3-10-26-45,46-27-11-4-12-28-46)55-32-14-13-31-53(55)62-54/h1-41H |
| InChIKey | JIHMQTCDOXWOIO-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.23 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|