C28H25F3N2O3S — CID 140955272
[3-[2,6-di(propan-2-yl)phenyl]imidazo[1,2-f]phenanthridin-11-yl] trifluoromethanesulfonate (PubChem CID 140955272) has the molecular formula C28H25F3N2O3S and a molecular weight of 526.58 g/mol. Its IUPAC name is [3-[2,6-di(propan-2-yl)phenyl]imidazo[1,2-f]phenanthridin-11-yl] trifluoromethanesulfonate.
| Compound Name | [3-[2,6-di(propan-2-yl)phenyl]imidazo[1,2-f]phenanthridin-11-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 140955272 |
| Molecular Formula | C28H25F3N2O3S |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | [3-[2,6-di(propan-2-yl)phenyl]imidazo[1,2-f]phenanthridin-11-yl] trifluoromethanesulfonate |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1cnc2c3cc(OS(=O)(=O)C(F)(F)F)ccc3c3ccccc3n12 |
| InChI | InChI=1S/C28H25F3N2O3S/c1-16(2)19-9-7-10-20(17(3)4)26(19)25-15-32-27-23-14-18(36-37(34,35)28(29,30)31)12-13-21(23)22-8-5-6-11-24(22)33(25)27/h5-17H,1-4H3 |
| InChIKey | ZTLKLMADAMJFTJ-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|