C9H8N2 — CID 140956214
3-methyl-4-methylidenepyrrolo[2,3-b]pyridine (PubChem CID 140956214) has the molecular formula C9H8N2 and a molecular weight of 144.18 g/mol. Its IUPAC name is 3-methyl-4-methylidenepyrrolo[2,3-b]pyridine.
| Compound Name | 3-methyl-4-methylidenepyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 140956214 |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 3-methyl-4-methylidenepyrrolo[2,3-b]pyridine |
| SMILES | C=c1ccnc2c1=C(C)C=N2 |
| InChI | InChI=1S/C9H8N2/c1-6-3-4-10-9-8(6)7(2)5-11-9/h3-5H,1H2,2H3 |
| InChIKey | ZUKILACYIOKGAG-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |