C49H92OSi — CID 140956873
[3,3-bis[(10Z,13Z)-nonadeca-10,13-dienyl]cyclopentyl]oxy-tert-butyl-dimethylsilane (PubChem CID 140956873) has the molecular formula C49H92OSi and a molecular weight of 725.36 g/mol. Its IUPAC name is [3,3-bis[(10Z,13Z)-nonadeca-10,13-dienyl]cyclopentyl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [3,3-bis[(10Z,13Z)-nonadeca-10,13-dienyl]cyclopentyl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 140956873 |
| Molecular Formula | C49H92OSi |
| Molecular Weight | 725.36 g/mol |
| Exact Mass | 724.69 |
| IUPAC Name | [3,3-bis[(10Z,13Z)-nonadeca-10,13-dienyl]cyclopentyl]oxy-tert-butyl-dimethylsilane |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC1(CCCCCCCCC/C=C\C/C=C\CCCCC)CCC(O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C49H92OSi/c1-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-40-43-49(45-42-47(46-49)50-51(6,7)48(3,4)5)44-41-39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-2/h16-19,22-25,47H,8-15,20-21,26-46H2,1-7H3/b18-16-,19-17-,24-22-,25-23- |
| InChIKey | KWRGOXDZSMEEHB-HBZIWDQGSA-N |
| XLogP | 17.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.36 |
| LogP ≤ 5 | 17.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|