C29H37BF3N3O3 — CID 140957073
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[4-(trifluoromethoxy)phenyl]-1-(3,3,5-trimethylcyclohexyl)benzimidazol-2-amine (PubChem CID 140957073) has the molecular formula C29H37BF3N3O3 and a molecular weight of 543.44 g/mol. Its IUPAC name is 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[4-(trifluoromethoxy)phenyl]-1-(3,3,5-trimethylcyclohexyl)benzimidazol-2-amine.
| Compound Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[4-(trifluoromethoxy)phenyl]-1-(3,3,5-trimethylcyclohexyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 140957073 |
| Molecular Formula | C29H37BF3N3O3 |
| Molecular Weight | 543.44 g/mol |
| Exact Mass | 543.29 |
| IUPAC Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[4-(trifluoromethoxy)phenyl]-1-(3,3,5-trimethylcyclohexyl)benzimidazol-2-amine |
| SMILES | CC1CC(n2c(Nc3ccc(OC(F)(F)F)cc3)nc3cc(B4OC(C)(C)C(C)(C)O4)ccc32)CC(C)(C)C1 |
| InChI | InChI=1S/C29H37BF3N3O3/c1-18-14-21(17-26(2,3)16-18)36-24-13-8-19(30-38-27(4,5)28(6,7)39-30)15-23(24)35-25(36)34-20-9-11-22(12-10-20)37-29(31,32)33/h8-13,15,18,21H,14,16-17H2,1-7H3,(H,34,35) |
| InChIKey | GSEORNRYENFIEL-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.44 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|