C58H88O12 — CID 140957666
2,3,8,9-tetrakis[7-(2-ethoxyethenoxy)heptoxy]tetracyclo[5.5.2.04,13.010,14]tetradeca-1,3,5,7,9,11,13-heptaene (PubChem CID 140957666) has the molecular formula C58H88O12 and a molecular weight of 977.33 g/mol. Its IUPAC name is 2,3,8,9-tetrakis[7-(2-ethoxyethenoxy)heptoxy]tetracyclo[5.5.2.04,13.010,14]tetradeca-1,3,5,7,9,11,13-heptaene.
| Compound Name | 2,3,8,9-tetrakis[7-(2-ethoxyethenoxy)heptoxy]tetracyclo[5.5.2.04,13.010,14]tetradeca-1,3,5,7,9,11,13-heptaene |
|---|---|
| PubChem CID | 140957666 |
| Molecular Formula | C58H88O12 |
| Molecular Weight | 977.33 g/mol |
| Exact Mass | 976.63 |
| IUPAC Name | 2,3,8,9-tetrakis[7-(2-ethoxyethenoxy)heptoxy]tetracyclo[5.5.2.04,13.010,14]tetradeca-1,3,5,7,9,11,13-heptaene |
| SMILES | CCOC=COCCCCCCCOC1=c2ccc3c4c(ccc(c24)=C1OCCCCCCCOC=COCC)=C(OCCCCCCCOC=COCC)C=3OCCCCCCCOC=COCC |
| InChI | InChI=1S/C58H88O12/c1-5-59-41-45-63-33-21-13-9-17-25-37-67-55-49-29-30-51-54-52(32-31-50(53(49)54)56(55)68-38-26-18-10-14-22-34-64-46-42-60-6-2)58(70-40-28-20-12-16-24-36-66-48-44-62-8-4)57(51)69-39-27-19-11-15-23-35-65-47-43-61-7-3/h29-32,41-48H,5-28,33-40H2,1-4H3 |
| InChIKey | ASGWPZLIBGKZPP-UHFFFAOYSA-N |
| XLogP | 11.27 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.33 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|