C22H26B2 — CID 140958135
(7R,9S)-2,8-diphenyl-2,8-diboratricyclo[7.3.0.03,7]dodecane (PubChem CID 140958135) has the molecular formula C22H26B2 and a molecular weight of 312.07 g/mol. Its IUPAC name is (7R,9S)-2,8-diphenyl-2,8-diboratricyclo[7.3.0.03,7]dodecane.
| Compound Name | (7R,9S)-2,8-diphenyl-2,8-diboratricyclo[7.3.0.03,7]dodecane |
|---|---|
| PubChem CID | 140958135 |
| Molecular Formula | C22H26B2 |
| Molecular Weight | 312.07 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | (7R,9S)-2,8-diphenyl-2,8-diboratricyclo[7.3.0.03,7]dodecane |
| SMILES | c1ccc(B2C3CCC[C@@H]3B(c3ccccc3)[C@@H]3CCCC23)cc1 |
| InChI | InChI=1S/C22H26B2/c1-3-9-17(10-4-1)23-19-13-7-15-21(19)24(18-11-5-2-6-12-18)22-16-8-14-20(22)23/h1-6,9-12,19-22H,7-8,13-16H2/t19-,20+,21?,22? |
| InChIKey | LYKRGDKQOJYAEW-FDRBHKFBSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.07 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|