C17H26ClN3O7 — CID 140958230
3-[3-[2-(3-chloropropoxy)ethyl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]propanamide (PubChem CID 140958230) has the molecular formula C17H26ClN3O7 and a molecular weight of 419.86 g/mol. Its IUPAC name is 3-[3-[2-(3-chloropropoxy)ethyl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]propanamide.
| Compound Name | 3-[3-[2-(3-chloropropoxy)ethyl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]propanamide |
|---|---|
| PubChem CID | 140958230 |
| Molecular Formula | C17H26ClN3O7 |
| Molecular Weight | 419.86 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 3-[3-[2-(3-chloropropoxy)ethyl]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]propanamide |
| SMILES | NC(=O)CCc1cn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)n(CCOCCCCl)c1=O |
| InChI | InChI=1S/C17H26ClN3O7/c18-4-1-6-27-7-5-20-16(25)11(2-3-14(19)24)9-21(17(20)26)15-8-12(23)13(10-22)28-15/h9,12-13,15,22-23H,1-8,10H2,(H2,19,24)/t12-,13+,15+/m0/s1 |
| InChIKey | QIMNHDFIBINTLD-GZBFAFLISA-N |
| XLogP | -1.29 |
| TPSA | 146.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.86 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|