About CID 140958242
CID 140958242 (PubChem CID 140958242) has the molecular formula C37H33N5OPt
and a molecular weight of 758.78 g/mol.
Molecular Properties
| Compound Name | CID 140958242 |
| PubChem CID | 140958242 |
| Molecular Formula | C37H33N5OPt |
| Molecular Weight | 758.78 g/mol |
| Exact Mass | 758.23 |
| IUPAC Name | — |
| SMILES | Cc1cc(Oc2[c-]c3c(cc2)c2cccc4c2n3-c2ncccc2C4(C)C)[c-]c(N2CN(C(C)C)c3ccc(C)nc32)c1.[Pt+2] |
| InChI | InChI=1S/C37H33N5O.Pt/c1-22(2)40-21-41(36-32(40)15-12-24(4)39-36)25-17-23(3)18-27(19-25)43-26-13-14-28-29-9-7-10-30-34(29)42(33(28)20-26)35-31(37(30,5)6)11-8-16-38-35;/h7-18,22H,21H2,1-6H3;/q-2;+2 |
| InChIKey | FOORWSZLKVBFBF-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 758.78 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 140958242 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140958242?
The IUPAC name of CID 140958242 (CID 140958242) is not available.
What is the SMILES notation for CID 140958242?
The canonical SMILES for CID 140958242 is Cc1cc(Oc2[c-]c3c(cc2)c2cccc4c2n3-c2ncccc2C4(C)C)[c-]c(N2CN(C(C)C)c3ccc(C)nc32)c1.[Pt+2].
What is the InChIKey of CID 140958242?
The InChIKey is FOORWSZLKVBFBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H33N5O.Pt/c1-22(2)40-21-41(36-32(40)15-12-24(4)39-36)25-17-23(3)18-27(19-25)43-26-13-14-28-29-9-7-10-30-34(29)42(33(28)20-26)35-31(37(30,5)6)11-8-16-38-35;/h7-18,22H,21H2,1-6H3;/q-2;+2.
What are the key properties of CID 140958242?
CID 140958242 has a molecular weight of 758.78 g/mol, XLogP of 8.54, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140958242 is sourced from PubChem (CID 140958242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).