C18H18N6O2S — CID 140959373
4-[1-[1-ethenylsulfonyl-3-(isocyanomethyl)pyrrolidin-3-yl]pyrrol-3-yl]-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 140959373) has the molecular formula C18H18N6O2S and a molecular weight of 382.45 g/mol. Its IUPAC name is 4-[1-[1-ethenylsulfonyl-3-(isocyanomethyl)pyrrolidin-3-yl]pyrrol-3-yl]-7H-pyrrolo[2,3-d]pyrimidine.
| Compound Name | 4-[1-[1-ethenylsulfonyl-3-(isocyanomethyl)pyrrolidin-3-yl]pyrrol-3-yl]-7H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 140959373 |
| Molecular Formula | C18H18N6O2S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 4-[1-[1-ethenylsulfonyl-3-(isocyanomethyl)pyrrolidin-3-yl]pyrrol-3-yl]-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | [C-]#[N+]CC1(n2ccc(-c3ncnc4[nH]ccc34)c2)CCN(S(=O)(=O)C=C)C1 |
| InChI | InChI=1S/C18H18N6O2S/c1-3-27(25,26)24-9-6-18(12-24,11-19-2)23-8-5-14(10-23)16-15-4-7-20-17(15)22-13-21-16/h3-5,7-8,10,13H,1,6,9,11-12H2,(H,20,21,22) |
| InChIKey | JTFILYWPBQQPHM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|