C20H31BF2N2O2 — CID 140959395
1-[[3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-4-propan-2-ylpiperazine (PubChem CID 140959395) has the molecular formula C20H31BF2N2O2 and a molecular weight of 380.29 g/mol. Its IUPAC name is 1-[[3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-4-propan-2-ylpiperazine.
| Compound Name | 1-[[3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 140959395 |
| Molecular Formula | C20H31BF2N2O2 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | 1-[[3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-4-propan-2-ylpiperazine |
| SMILES | CC(C)N1CCN(Cc2cc(F)c(B3OC(C)(C)C(C)(C)O3)c(F)c2)CC1 |
| InChI | InChI=1S/C20H31BF2N2O2/c1-14(2)25-9-7-24(8-10-25)13-15-11-16(22)18(17(23)12-15)21-26-19(3,4)20(5,6)27-21/h11-12,14H,7-10,13H2,1-6H3 |
| InChIKey | ZKWWMCLCTJUINX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|