About CID 140959559
CID 140959559 (PubChem CID 140959559) has the molecular formula C17H30NO5
and a molecular weight of 328.43 g/mol.
Molecular Properties
| Compound Name | CID 140959559 |
| PubChem CID | 140959559 |
| Molecular Formula | C17H30NO5 |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(COOC2CCC(OC=O)CC2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C17H30NO5/c1-16(2)9-13(10-17(3,4)18(16)20)11-22-23-15-7-5-14(6-8-15)21-12-19/h12-15H,5-11H2,1-4H3 |
| InChIKey | LJNBVXTVUWGWHQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 67.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 140959559 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140959559?
The IUPAC name of CID 140959559 (CID 140959559) is not available.
What is the SMILES notation for CID 140959559?
The canonical SMILES for CID 140959559 is CC1(C)CC(COOC2CCC(OC=O)CC2)CC(C)(C)N1[O].
What is the InChIKey of CID 140959559?
The InChIKey is LJNBVXTVUWGWHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30NO5/c1-16(2)9-13(10-17(3,4)18(16)20)11-22-23-15-7-5-14(6-8-15)21-12-19/h12-15H,5-11H2,1-4H3.
What are the key properties of CID 140959559?
CID 140959559 has a molecular weight of 328.43 g/mol, XLogP of 3.03, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140959559 is sourced from PubChem (CID 140959559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).