C17H16N4O — CID 140959607
4-(11-ethyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl)-3,5-dimethyl-1,2-oxazole (PubChem CID 140959607) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is 4-(11-ethyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl)-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-(11-ethyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl)-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 140959607 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 4-(11-ethyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl)-3,5-dimethyl-1,2-oxazole |
| SMILES | CCc1cc2[nH]c3cc(-c4c(C)noc4C)cnc3c2cn1 |
| InChI | InChI=1S/C17H16N4O/c1-4-12-6-14-13(8-18-12)17-15(20-14)5-11(7-19-17)16-9(2)21-22-10(16)3/h5-8,20H,4H2,1-3H3 |
| InChIKey | WLRLZVOERHTQPF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |