C21H24ClNO4 — CID 1409597
[2-(3-chloro-4-methylanilino)-2-oxoethyl] 2-(4-tert-butylphenoxy)acetate (PubChem CID 1409597) has the molecular formula C21H24ClNO4 and a molecular weight of 389.88 g/mol. Its IUPAC name is [2-(3-chloro-4-methylanilino)-2-oxoethyl] 2-(4-tert-butylphenoxy)acetate.
| Compound Name | [2-(3-chloro-4-methylanilino)-2-oxoethyl] 2-(4-tert-butylphenoxy)acetate |
|---|---|
| PubChem CID | 1409597 |
| Molecular Formula | C21H24ClNO4 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | [2-(3-chloro-4-methylanilino)-2-oxoethyl] 2-(4-tert-butylphenoxy)acetate |
| SMILES | Cc1ccc(NC(=O)COC(=O)COc2ccc(C(C)(C)C)cc2)cc1Cl |
| InChI | InChI=1S/C21H24ClNO4/c1-14-5-8-16(11-18(14)22)23-19(24)12-27-20(25)13-26-17-9-6-15(7-10-17)21(2,3)4/h5-11H,12-13H2,1-4H3,(H,23,24) |
| InChIKey | NFCQNXQQWOEVMN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |