C20H17N5O3S — CID 140960304
5-[5-(8-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-11-yl)indazol-1-yl]-1-oxo-1,2-thiazol-3-one (PubChem CID 140960304) has the molecular formula C20H17N5O3S and a molecular weight of 407.46 g/mol. Its IUPAC name is 5-[5-(8-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-11-yl)indazol-1-yl]-1-oxo-1,2-thiazol-3-one.
| Compound Name | 5-[5-(8-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-11-yl)indazol-1-yl]-1-oxo-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 140960304 |
| Molecular Formula | C20H17N5O3S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 5-[5-(8-oxa-2,13-diazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-11-yl)indazol-1-yl]-1-oxo-1,2-thiazol-3-one |
| SMILES | O=C1C=C(n2ncc3cc(-c4cnc5c(c4)OCC4CCCN54)ccc32)S(=O)N1 |
| InChI | InChI=1S/C20H17N5O3S/c26-18-8-19(29(27)23-18)25-16-4-3-12(6-14(16)10-22-25)13-7-17-20(21-9-13)24-5-1-2-15(24)11-28-17/h3-4,6-10,15H,1-2,5,11H2,(H,23,26) |
| InChIKey | XULKCSFBGGVKKA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |