About 5-[5-[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]indazol-1-yl]-1-oxo-1,2-thiazol-3-one
5-[5-[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]indazol-1-yl]-1-oxo-1,2-thiazol-3-one (PubChem CID 140960429) has the molecular formula C19H15F2N5O2S
and a molecular weight of 415.43 g/mol. Its IUPAC name is 5-[5-[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]indazol-1-yl]-1-oxo-1,2-thiazol-3-one.
Molecular Properties
| Compound Name | 5-[5-[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]indazol-1-yl]-1-oxo-1,2-thiazol-3-one |
| PubChem CID | 140960429 |
| Molecular Formula | C19H15F2N5O2S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 5-[5-[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]indazol-1-yl]-1-oxo-1,2-thiazol-3-one |
| SMILES | O=C1C=C(n2ncc3cc(-c4ccc(N5CCC(F)(F)C5)nc4)ccc32)S(=O)N1 |
| InChI | InChI=1S/C19H15F2N5O2S/c20-19(21)5-6-25(11-19)16-4-2-13(9-22-16)12-1-3-15-14(7-12)10-23-26(15)18-8-17(27)24-29(18)28/h1-4,7-10H,5-6,11H2,(H,24,27) |
| InChIKey | DWMYHGIXZXIIPE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[5-[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]indazol-1-yl]-1-oxo-1,2-thiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]indazol-1-yl]-1-oxo-1,2-thiazol-3-one?
The IUPAC name of 5-[5-[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]indazol-1-yl]-1-oxo-1,2-thiazol-3-one (CID 140960429) is 5-[5-[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]indazol-1-yl]-1-oxo-1,2-thiazol-3-one.
What is the SMILES notation for 5-[5-[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]indazol-1-yl]-1-oxo-1,2-thiazol-3-one?
The canonical SMILES for 5-[5-[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]indazol-1-yl]-1-oxo-1,2-thiazol-3-one is O=C1C=C(n2ncc3cc(-c4ccc(N5CCC(F)(F)C5)nc4)ccc32)S(=O)N1.
What is the InChIKey of 5-[5-[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]indazol-1-yl]-1-oxo-1,2-thiazol-3-one?
The InChIKey is DWMYHGIXZXIIPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15F2N5O2S/c20-19(21)5-6-25(11-19)16-4-2-13(9-22-16)12-1-3-15-14(7-12)10-23-26(15)18-8-17(27)24-29(18)28/h1-4,7-10H,5-6,11H2,(H,24,27).
What are the key properties of 5-[5-[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]indazol-1-yl]-1-oxo-1,2-thiazol-3-one?
5-[5-[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]indazol-1-yl]-1-oxo-1,2-thiazol-3-one has a molecular weight of 415.43 g/mol, XLogP of 2.54, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-[6-(3,3-difluoropyrrolidin-1-yl)-3-pyridinyl]indazol-1-yl]-1-oxo-1,2-thiazol-3-one is sourced from PubChem (CID 140960429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).