C21H20N4O3S — CID 140960539
5-[5-[3-(morpholin-4-ylmethyl)phenyl]indazol-1-yl]-1-oxo-1,2-thiazol-3-one (PubChem CID 140960539) has the molecular formula C21H20N4O3S and a molecular weight of 408.48 g/mol. Its IUPAC name is 5-[5-[3-(morpholin-4-ylmethyl)phenyl]indazol-1-yl]-1-oxo-1,2-thiazol-3-one.
| Compound Name | 5-[5-[3-(morpholin-4-ylmethyl)phenyl]indazol-1-yl]-1-oxo-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 140960539 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 5-[5-[3-(morpholin-4-ylmethyl)phenyl]indazol-1-yl]-1-oxo-1,2-thiazol-3-one |
| SMILES | O=C1C=C(n2ncc3cc(-c4cccc(CN5CCOCC5)c4)ccc32)S(=O)N1 |
| InChI | InChI=1S/C21H20N4O3S/c26-20-12-21(29(27)23-20)25-19-5-4-17(11-18(19)13-22-25)16-3-1-2-15(10-16)14-24-6-8-28-9-7-24/h1-5,10-13H,6-9,14H2,(H,23,26) |
| InChIKey | BGCPELNTWXIOKF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |