C13H15N4O2- — CID 140961349
2-N-oxido-4-(5-propan-2-yloxypyrimidin-4-yl)benzene-1,2-diamine (PubChem CID 140961349) has the molecular formula C13H15N4O2- and a molecular weight of 259.29 g/mol. Its IUPAC name is 2-N-oxido-4-(5-propan-2-yloxypyrimidin-4-yl)benzene-1,2-diamine.
| Compound Name | 2-N-oxido-4-(5-propan-2-yloxypyrimidin-4-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 140961349 |
| Molecular Formula | C13H15N4O2- |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-N-oxido-4-(5-propan-2-yloxypyrimidin-4-yl)benzene-1,2-diamine |
| SMILES | CC(C)Oc1cncnc1-c1ccc(N)c(N[O-])c1 |
| InChI | InChI=1S/C13H15N4O2/c1-8(2)19-12-6-15-7-16-13(12)9-3-4-10(14)11(5-9)17-18/h3-8,17H,14H2,1-2H3/q-1 |
| InChIKey | JDZGUQYWLWMTPA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 96.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|