C16H25BN2O5 — CID 140961356
2-(2-methylpropoxy)-6-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 140961356) has the molecular formula C16H25BN2O5 and a molecular weight of 336.20 g/mol. Its IUPAC name is 2-(2-methylpropoxy)-6-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | 2-(2-methylpropoxy)-6-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 140961356 |
| Molecular Formula | C16H25BN2O5 |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 2-(2-methylpropoxy)-6-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | CC(C)COc1c(B2OC(C)(C)C(C)(C)O2)ccc([N+](=O)[O-])c1N |
| InChI | InChI=1S/C16H25BN2O5/c1-10(2)9-22-14-11(7-8-12(13(14)18)19(20)21)17-23-15(3,4)16(5,6)24-17/h7-8,10H,9,18H2,1-6H3 |
| InChIKey | HKRYIXZJMNBRFN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|