C11H13N4O- — CID 140961395
4-(1-ethylpyrazol-4-yl)-2-N-oxidobenzene-1,2-diamine (PubChem CID 140961395) has the molecular formula C11H13N4O- and a molecular weight of 217.25 g/mol. Its IUPAC name is 4-(1-ethylpyrazol-4-yl)-2-N-oxidobenzene-1,2-diamine.
| Compound Name | 4-(1-ethylpyrazol-4-yl)-2-N-oxidobenzene-1,2-diamine |
|---|---|
| PubChem CID | 140961395 |
| Molecular Formula | C11H13N4O- |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 4-(1-ethylpyrazol-4-yl)-2-N-oxidobenzene-1,2-diamine |
| SMILES | CCn1cc(-c2ccc(N)c(N[O-])c2)cn1 |
| InChI | InChI=1S/C11H13N4O/c1-2-15-7-9(6-13-15)8-3-4-10(12)11(5-8)14-16/h3-7,14H,2,12H2,1H3/q-1 |
| InChIKey | DGMNCKMIEKUINZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 78.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|