C21H28N3O2+ — CID 140963280
4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-N,N-diethyl-3,5-dimethoxyaniline (PubChem CID 140963280) has the molecular formula C21H28N3O2+ and a molecular weight of 354.47 g/mol. Its IUPAC name is 4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-N,N-diethyl-3,5-dimethoxyaniline.
| Compound Name | 4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-N,N-diethyl-3,5-dimethoxyaniline |
|---|---|
| PubChem CID | 140963280 |
| Molecular Formula | C21H28N3O2+ |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-N,N-diethyl-3,5-dimethoxyaniline |
| SMILES | CCN(CC)c1cc(OC)c(-c2n(C)c3ccccc3[n+]2C)c(OC)c1 |
| InChI | InChI=1S/C21H28N3O2/c1-7-24(8-2)15-13-18(25-5)20(19(14-15)26-6)21-22(3)16-11-9-10-12-17(16)23(21)4/h9-14H,7-8H2,1-6H3/q+1 |
| InChIKey | OYSBRKKDLATWAY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 30.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|