About ethyl 5-(aminomethyl)pyridine-3-carboxylate;dihydrochloride
ethyl 5-(aminomethyl)pyridine-3-carboxylate;dihydrochloride (PubChem CID 140963506) has the molecular formula C9H14Cl2N2O2
and a molecular weight of 253.13 g/mol. Its IUPAC name is ethyl 5-(aminomethyl)pyridine-3-carboxylate;dihydrochloride.
Molecular Properties
| Compound Name | ethyl 5-(aminomethyl)pyridine-3-carboxylate;dihydrochloride |
| PubChem CID | 140963506 |
| Molecular Formula | C9H14Cl2N2O2 |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | ethyl 5-(aminomethyl)pyridine-3-carboxylate;dihydrochloride |
| SMILES | CCOC(=O)c1cncc(CN)c1.Cl.Cl |
| InChI | InChI=1S/C9H12N2O2.2ClH/c1-2-13-9(12)8-3-7(4-10)5-11-6-8;;/h3,5-6H,2,4,10H2,1H3;2*1H |
| InChIKey | KKFYFNWAMLJIEA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 5-(aminomethyl)pyridine-3-carboxylate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(aminomethyl)pyridine-3-carboxylate;dihydrochloride?
The IUPAC name of ethyl 5-(aminomethyl)pyridine-3-carboxylate;dihydrochloride (CID 140963506) is ethyl 5-(aminomethyl)pyridine-3-carboxylate;dihydrochloride.
What is the SMILES notation for ethyl 5-(aminomethyl)pyridine-3-carboxylate;dihydrochloride?
The canonical SMILES for ethyl 5-(aminomethyl)pyridine-3-carboxylate;dihydrochloride is CCOC(=O)c1cncc(CN)c1.Cl.Cl.
What is the InChIKey of ethyl 5-(aminomethyl)pyridine-3-carboxylate;dihydrochloride?
The InChIKey is KKFYFNWAMLJIEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2.2ClH/c1-2-13-9(12)8-3-7(4-10)5-11-6-8;;/h3,5-6H,2,4,10H2,1H3;2*1H.
What are the key properties of ethyl 5-(aminomethyl)pyridine-3-carboxylate;dihydrochloride?
ethyl 5-(aminomethyl)pyridine-3-carboxylate;dihydrochloride has a molecular weight of 253.13 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(aminomethyl)pyridine-3-carboxylate;dihydrochloride is sourced from PubChem (CID 140963506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).