C40H23N3O — CID 140963548
6-[4-(7-isocyano-9-phenylcarbazol-3-yl)phenyl]chromeno[4,3-b]indole (PubChem CID 140963548) has the molecular formula C40H23N3O and a molecular weight of 561.64 g/mol. Its IUPAC name is 6-[4-(7-isocyano-9-phenylcarbazol-3-yl)phenyl]chromeno[4,3-b]indole.
| Compound Name | 6-[4-(7-isocyano-9-phenylcarbazol-3-yl)phenyl]chromeno[4,3-b]indole |
|---|---|
| PubChem CID | 140963548 |
| Molecular Formula | C40H23N3O |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | 6-[4-(7-isocyano-9-phenylcarbazol-3-yl)phenyl]chromeno[4,3-b]indole |
| SMILES | [C-]#[N+]c1ccc2c3cc(-c4ccc(-c5oc6ccccc6c6nc7ccccc7c5-6)cc4)ccc3n(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C40H23N3O/c1-41-28-20-21-30-33-23-27(19-22-35(33)43(36(30)24-28)29-9-3-2-4-10-29)25-15-17-26(18-16-25)40-38-31-11-5-7-13-34(31)42-39(38)32-12-6-8-14-37(32)44-40/h2-24H |
| InChIKey | GAFPAFVFNCVIFN-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 35.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|