C10H9F3N2O3 — CID 140963621
(2-oxo-5,6,7,8-tetrahydro-1,7-naphthyridin-1-yl) 2,2,2-trifluoroacetate (PubChem CID 140963621) has the molecular formula C10H9F3N2O3 and a molecular weight of 262.19 g/mol. Its IUPAC name is (2-oxo-5,6,7,8-tetrahydro-1,7-naphthyridin-1-yl) 2,2,2-trifluoroacetate.
| Compound Name | (2-oxo-5,6,7,8-tetrahydro-1,7-naphthyridin-1-yl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140963621 |
| Molecular Formula | C10H9F3N2O3 |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | (2-oxo-5,6,7,8-tetrahydro-1,7-naphthyridin-1-yl) 2,2,2-trifluoroacetate |
| SMILES | O=C(On1c2c(ccc1=O)CCNC2)C(F)(F)F |
| InChI | InChI=1S/C10H9F3N2O3/c11-10(12,13)9(17)18-15-7-5-14-4-3-6(7)1-2-8(15)16/h1-2,14H,3-5H2 |
| InChIKey | SPROZMGNXVBPFR-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |