C25H27N7O4 — CID 140963667
N-[(1S)-2-(dimethylamino)-1-phenylethyl]-3-[(3-nitrobenzoyl)amino]spiro[1,4-dihydropyrrolo[3,4-d]pyrazole-6,1'-cyclopropane]-5-carboxamide (PubChem CID 140963667) has the molecular formula C25H27N7O4 and a molecular weight of 489.54 g/mol. Its IUPAC name is N-[(1S)-2-(dimethylamino)-1-phenylethyl]-3-[(3-nitrobenzoyl)amino]spiro[1,4-dihydropyrrolo[3,4-d]pyrazole-6,1'-cyclopropane]-5-carboxamide.
| Compound Name | N-[(1S)-2-(dimethylamino)-1-phenylethyl]-3-[(3-nitrobenzoyl)amino]spiro[1,4-dihydropyrrolo[3,4-d]pyrazole-6,1'-cyclopropane]-5-carboxamide |
|---|---|
| PubChem CID | 140963667 |
| Molecular Formula | C25H27N7O4 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | N-[(1S)-2-(dimethylamino)-1-phenylethyl]-3-[(3-nitrobenzoyl)amino]spiro[1,4-dihydropyrrolo[3,4-d]pyrazole-6,1'-cyclopropane]-5-carboxamide |
| SMILES | CN(C)C[C@@H](NC(=O)N1Cc2c(NC(=O)c3cccc([N+](=O)[O-])c3)n[nH]c2C12CC2)c1ccccc1 |
| InChI | InChI=1S/C25H27N7O4/c1-30(2)15-20(16-7-4-3-5-8-16)26-24(34)31-14-19-21(25(31)11-12-25)28-29-22(19)27-23(33)17-9-6-10-18(13-17)32(35)36/h3-10,13,20H,11-12,14-15H2,1-2H3,(H,26,34)(H2,27,28,29,33)/t20-/m1/s1 |
| InChIKey | PQMZBYFOYFAROV-HXUWFJFHSA-N |
| XLogP | 3.39 |
| TPSA | 136.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|