C28H30F6N4O3 — CID 1409637
1-[(4R)-1-[2-(cyclohexen-1-yl)ethyl]-5,5-dimethyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-4-yl]-1-hydroxy-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 1409637) has the molecular formula C28H30F6N4O3 and a molecular weight of 584.56 g/mol. Its IUPAC name is 1-[(4R)-1-[2-(cyclohexen-1-yl)ethyl]-5,5-dimethyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-4-yl]-1-hydroxy-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(4R)-1-[2-(cyclohexen-1-yl)ethyl]-5,5-dimethyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-4-yl]-1-hydroxy-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 1409637 |
| Molecular Formula | C28H30F6N4O3 |
| Molecular Weight | 584.56 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | 1-[(4R)-1-[2-(cyclohexen-1-yl)ethyl]-5,5-dimethyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-4-yl]-1-hydroxy-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CC1(C)[C@@H](N(O)C(=O)Nc2cccc(C(F)(F)F)c2)N(c2cccc(C(F)(F)F)c2)C(=O)N1CCC1=CCCCC1 |
| InChI | InChI=1S/C28H30F6N4O3/c1-26(2)23(38(41)24(39)35-21-12-6-10-19(16-21)27(29,30)31)37(22-13-7-11-20(17-22)28(32,33)34)25(40)36(26)15-14-18-8-4-3-5-9-18/h6-8,10-13,16-17,23,41H,3-5,9,14-15H2,1-2H3,(H,35,39)/t23-/m1/s1 |
| InChIKey | AVFRNMDNTJSZPX-HSZRJFAPSA-N |
| XLogP | 7.88 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.56 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|