C20H19Cl2N2O+ — CID 1409639
1-[(3,4-dichlorophenyl)methyl]-3-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium (PubChem CID 1409639) has the molecular formula C20H19Cl2N2O+ and a molecular weight of 374.29 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium |
|---|---|
| PubChem CID | 1409639 |
| Molecular Formula | C20H19Cl2N2O+ |
| Molecular Weight | 374.29 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium |
| SMILES | COc1ccc(-c2c[n+](Cc3ccc(Cl)c(Cl)c3)c3n2CCC3)cc1 |
| InChI | InChI=1S/C20H19Cl2N2O/c1-25-16-7-5-15(6-8-16)19-13-23(20-3-2-10-24(19)20)12-14-4-9-17(21)18(22)11-14/h4-9,11,13H,2-3,10,12H2,1H3/q+1 |
| InChIKey | LFBPXWXKNNGRST-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.29 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|