C24H27N2+ — CID 140964590
4-cyclopentyl-4-deuterio-1,3-dimethyl-2-(2-methylphenyl)imidazo[1,5-a]indol-2-ium (PubChem CID 140964590) has the molecular formula C24H27N2+ and a molecular weight of 344.50 g/mol. Its IUPAC name is 4-cyclopentyl-4-deuterio-1,3-dimethyl-2-(2-methylphenyl)imidazo[1,5-a]indol-2-ium.
| Compound Name | 4-cyclopentyl-4-deuterio-1,3-dimethyl-2-(2-methylphenyl)imidazo[1,5-a]indol-2-ium |
|---|---|
| PubChem CID | 140964590 |
| Molecular Formula | C24H27N2+ |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 4-cyclopentyl-4-deuterio-1,3-dimethyl-2-(2-methylphenyl)imidazo[1,5-a]indol-2-ium |
| SMILES | [2H]C1(C2CCCC2)c2ccccc2-n2c1c(C)[n+](-c1ccccc1C)c2C |
| InChI | InChI=1S/C24H27N2/c1-16-10-4-8-14-21(16)25-17(2)24-23(19-11-5-6-12-19)20-13-7-9-15-22(20)26(24)18(25)3/h4,7-10,13-15,19,23H,5-6,11-12H2,1-3H3/q+1/i23D |
| InChIKey | VQMCNLUWKYGSQE-WBQFYUNPSA-N |
| XLogP | 5.31 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|