C11H19NO2 — CID 140965568
(1R,3R,4S,7R)-4-(aminomethyl)adamantane-1,3-diol (PubChem CID 140965568) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is (1R,3R,4S,7R)-4-(aminomethyl)adamantane-1,3-diol.
| Compound Name | (1R,3R,4S,7R)-4-(aminomethyl)adamantane-1,3-diol |
|---|---|
| PubChem CID | 140965568 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (1R,3R,4S,7R)-4-(aminomethyl)adamantane-1,3-diol |
| SMILES | NC[C@@H]1C2C[C@@H]3C[C@@](O)(C2)C[C@]1(O)C3 |
| InChI | InChI=1S/C11H19NO2/c12-5-9-8-1-7-2-10(13,4-8)6-11(9,14)3-7/h7-9,13-14H,1-6,12H2/t7-,8?,9-,10-,11-/m1/s1 |
| InChIKey | IIMLVNNXVFIZEP-HWMGSYRZSA-N |
| XLogP | 0.25 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |