C20H31BrF6N2O3SSi — CID 140966007
(R)-N-[(2R)-2-(6-bromo-3-fluoro-4-triethylsilyl-2-pyridinyl)-3,3,5,5,5-pentafluoro-4,4-dihydroxypentan-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 140966007) has the molecular formula C20H31BrF6N2O3SSi and a molecular weight of 601.52 g/mol. Its IUPAC name is (R)-N-[(2R)-2-(6-bromo-3-fluoro-4-triethylsilyl-2-pyridinyl)-3,3,5,5,5-pentafluoro-4,4-dihydroxypentan-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(2R)-2-(6-bromo-3-fluoro-4-triethylsilyl-2-pyridinyl)-3,3,5,5,5-pentafluoro-4,4-dihydroxypentan-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 140966007 |
| Molecular Formula | C20H31BrF6N2O3SSi |
| Molecular Weight | 601.52 g/mol |
| Exact Mass | 600.09 |
| IUPAC Name | (R)-N-[(2R)-2-(6-bromo-3-fluoro-4-triethylsilyl-2-pyridinyl)-3,3,5,5,5-pentafluoro-4,4-dihydroxypentan-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC[Si](CC)(CC)c1cc(Br)nc([C@@](C)(N[S@](=O)C(C)(C)C)C(F)(F)C(O)(O)C(F)(F)F)c1F |
| InChI | InChI=1S/C20H31BrF6N2O3SSi/c1-8-34(9-2,10-3)12-11-13(21)28-15(14(12)22)17(7,29-33(32)16(4,5)6)18(23,24)19(30,31)20(25,26)27/h11,29-31H,8-10H2,1-7H3/t17-,33-/m1/s1 |
| InChIKey | ZOVOKFHOIKJJFJ-UAIZEJDJSA-N |
| XLogP | 4.84 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|