C32H50N2O5Si — CID 140966119
tert-butyl N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-2-yl]carbamate (PubChem CID 140966119) has the molecular formula C32H50N2O5Si and a molecular weight of 570.85 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 140966119 |
| Molecular Formula | C32H50N2O5Si |
| Molecular Weight | 570.85 g/mol |
| Exact Mass | 570.35 |
| IUPAC Name | tert-butyl N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-2-yl]carbamate |
| SMILES | CC(CC[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H50N2O5Si/c1-24(33-28(35)38-30(2,3)4)21-22-25(34-29(36)39-31(5,6)7)23-37-40(32(8,9)10,26-17-13-11-14-18-26)27-19-15-12-16-20-27/h11-20,24-25H,21-23H2,1-10H3,(H,33,35)(H,34,36)/t24?,25-/m0/s1 |
| InChIKey | WYDFHEUONMJBOY-BBMPLOMVSA-N |
| XLogP | 6.15 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.85 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|