C29H52OSi — CID 140966234
[(3R,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-4,6,8-trienoxy]-tri(propan-2-yl)silane (PubChem CID 140966234) has the molecular formula C29H52OSi and a molecular weight of 444.82 g/mol. Its IUPAC name is [(3R,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-4,6,8-trienoxy]-tri(propan-2-yl)silane.
| Compound Name | [(3R,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-4,6,8-trienoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 140966234 |
| Molecular Formula | C29H52OSi |
| Molecular Weight | 444.82 g/mol |
| Exact Mass | 444.38 |
| IUPAC Name | [(3R,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-4,6,8-trienoxy]-tri(propan-2-yl)silane |
| SMILES | CC1=C(/C=C/C(C)=C\C=C\[C@H](C)CCO[Si](C(C)C)(C(C)C)C(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C29H52OSi/c1-22(2)31(23(3)4,24(5)6)30-21-19-26(8)15-12-14-25(7)17-18-28-27(9)16-13-20-29(28,10)11/h12,14-15,17-18,22-24,26H,13,16,19-21H2,1-11H3/b15-12+,18-17+,25-14-/t26-/m0/s1 |
| InChIKey | NHBANKRSQIGRPV-LSVJXXOUSA-N |
| XLogP | 9.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.82 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|